CAS 898561-71-2
:N-(2-Methoxy-4-pyridinyl)-2,2-dimethylpropanamide
Description:
N-(2-Methoxy-4-pyridinyl)-2,2-dimethylpropanamide, identified by its CAS number 898561-71-2, is a chemical compound characterized by its unique structural features. It contains a pyridine ring substituted with a methoxy group, which contributes to its potential biological activity. The presence of the dimethylpropanamide moiety suggests that it may exhibit properties typical of amides, such as stability and solubility in organic solvents. This compound may be of interest in medicinal chemistry due to its potential interactions with biological targets, possibly influencing pharmacological effects. Its molecular structure indicates that it could participate in hydrogen bonding and other intermolecular interactions, which are crucial for its reactivity and biological function. Additionally, the methoxy group can enhance lipophilicity, potentially affecting its absorption and distribution in biological systems. Overall, N-(2-Methoxy-4-pyridinyl)-2,2-dimethylpropanamide represents a compound with intriguing characteristics that may warrant further investigation in various chemical and pharmaceutical applications.
Formula:C11H16N2O2
InChI:InChI=1S/C11H16N2O2/c1-11(2,3)10(14)13-8-5-6-12-9(7-8)15-4/h5-7H,1-4H3,(H,12,13,14)
InChI key:InChIKey=CYKIARCTGVETIR-UHFFFAOYSA-N
SMILES:N(C(C(C)(C)C)=O)C=1C=C(OC)N=CC1
Synonyms:- N-(2-Methoxy-4-pyridinyl)-2,2-dimethylpropanamide
- Propanamide, N-(2-methoxy-4-pyridinyl)-2,2-dimethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
