CymitQuimica logo

CAS 89860-57-1

:

Methylbis(1-methylcyclohexyl)stannane

Description:
Methylbis(1-methylcyclohexyl)stannane, with the CAS number 89860-57-1, is an organotin compound characterized by the presence of a tin atom bonded to two 1-methylcyclohexyl groups and one methyl group. This compound typically exhibits a relatively high molecular weight and is known for its hydrophobic nature due to the bulky hydrocarbon groups attached to the tin atom. Organotin compounds like this one are often utilized in various industrial applications, including as stabilizers in PVC production and as biocides in marine coatings. The presence of the tin atom imparts unique properties, such as potential catalytic activity and the ability to form coordination complexes. However, organotin compounds can also pose environmental and health risks, leading to regulatory scrutiny. Methylbis(1-methylcyclohexyl)stannane may exhibit moderate to low solubility in water but is generally soluble in organic solvents. Safety precautions are essential when handling this compound, as organotin compounds can be toxic to aquatic life and may have adverse effects on human health.
Formula:C15H30Sn
InChI:InChI=1S/2C7H13.CH3.Sn.H/c2*1-7-5-3-2-4-6-7;;;/h2*2-6H2,1H3;1H3;;
InChI key:InChIKey=GSXPHHMIGFVEDI-UHFFFAOYSA-N
SMILES:[SnH](C)(C1(C)CCCCC1)C2(C)CCCCC2
Synonyms:
  • Methylbis(1-methylcyclohexyl)stannane
  • Stannane, methylbis(1-methylcyclohexyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.