3-Chloro-6-phenylpyridazin-4-ol is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a phenyl group at the 6-position contributes to its unique properties. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The hydroxyl group (-OH) at the 4-position enhances its potential for hydrogen bonding, influencing its reactivity and solubility in polar solvents. 3-Chloro-6-phenylpyridazin-4-ol may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the presence of chlorine and other functional groups can affect its safety profile.

C10H7ClN2O - InChI=1/C10H7ClN2O/c11-10-9(14)6-8(12-13-10)7-4-2-1-3-5-7/h1-6H,(H,12,14)

3-chloro-6-phenylpyridazin-4-ol

89868-13-3: 3-Chloro-6-phenylpyridazin-4-ol is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. The presence of a chlorine atom at the 3-position and a phenyl group at the 6-position contributes to its unique properties. This compound typically exhibits a solid state at room temperature and is soluble in organic solvents, reflecting its aromatic nature. The hydroxyl group (-OH) at the 4-position enhances its potential for hydrogen bonding, influencing its reactivity and solubility in polar solvents. 3-Chloro-6-phenylpyridazin-4-ol may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its structural features suggest potential applications in various fields, including pharmaceuticals and agrochemicals. As with many chemical substances, safety data sheets should be consulted for handling and toxicity information, as the presence of chlorine and other functional groups can affect its safety profile.

CAS 89868-13-3

3-chloro-6-phenylpyridazin-4-ol

4-Pyridazinol, 3-chloro-6-phenyl-

Ref: IN-DA00IFV0

3-Chloro-6-phenylpyridazin-4-ol

Ref: 54-OR1053058