CAS 89873-30-3
:P-[2-(Hydroxyamino)-2-oxoethyl]phosphonic acid
Description:
P-[2-(Hydroxyamino)-2-oxoethyl]phosphonic acid, with the CAS number 89873-30-3, is a phosphonic acid derivative characterized by its unique functional groups, including a phosphonic acid moiety and a hydroxyamino group. This compound typically exhibits properties associated with both phosphonates and amino acids, making it of interest in various biochemical applications. It is soluble in water, which enhances its utility in biological systems. The presence of the hydroxyamino group suggests potential reactivity in forming covalent bonds with other biomolecules, which can be significant in drug design and development. Additionally, the compound may exhibit chelating properties due to the presence of both the amino and hydroxyl functionalities, allowing it to interact with metal ions. Its structural features may also contribute to its role in metabolic pathways or as a potential inhibitor in enzymatic reactions. Overall, P-[2-(Hydroxyamino)-2-oxoethyl]phosphonic acid represents a versatile compound with potential applications in pharmaceuticals and biochemistry.
Formula:C2H6NO5P
InChI:InChI=1S/C2H6NO5P/c4-2(3-5)1-9(6,7)8/h5H,1H2,(H,3,4)(H2,6,7,8)
InChI key:InChIKey=LDKRAXXVBWHMRH-UHFFFAOYSA-N
SMILES:C(P(=O)(O)O)C(NO)=O
Synonyms:- Phosphonic acid, P-[2-(hydroxyamino)-2-oxoethyl]-
- P-[2-(Hydroxyamino)-2-oxoethyl]phosphonic acid
- [(Hydroxycarbamoyl)methyl]phosphonic acid
- Phosphonic acid, [2-(hydroxyamino)-2-oxoethyl]-
- PhAH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
2-(Hydroxyamino)-2-oxoethylphosphonic acid
CAS:2-(Hydroxyamino)-2-oxoethylphosphonic acid is an inhibitor of the enzyme senescent and is used to treat cancer. It inhibits the enzymatic reaction of the enzyme by binding to a hydrogen bond in the active site, thereby preventing its function. The compound has been shown to inhibit tumor growth in vitro and in vivo models. 2-(Hydroxyamino)-2-oxoethylphosphonic acid is also used for diagnostic purposes, as it can be detected in urine samples. This inhibitor binds to a water molecule that reacts with the phosphate group on the phosphonate backbone, which prevents it from binding to other phosphate groups on other molecules. This inhibition leads to a decrease in ATP production, which is essential for cell division.
Formula:C2H6NO5PPurity:Min. 95%Molecular weight:155.05 g/mol
