CAS 89874-80-6
:(R)-(+)-3-(3-hydroxyphenyl)-N-*propylpiperidine H
Description:
(R)-(+)-3-(3-hydroxyphenyl)-N-propylpiperidine H, with the CAS number 89874-80-6, is a chemical compound characterized by its piperidine core structure, which is a six-membered ring containing one nitrogen atom. This compound features a propyl group attached to the nitrogen atom and a 3-hydroxyphenyl group at the 3-position of the piperidine ring, contributing to its unique properties. The presence of the hydroxyl group on the phenyl ring enhances its potential for hydrogen bonding and may influence its solubility and reactivity. As an enantiomer, the (R)-(+)- designation indicates its specific stereochemistry, which can significantly affect its biological activity and interactions with receptors. This compound may be of interest in pharmaceutical research, particularly in the development of drugs targeting neurological or psychiatric conditions, due to its structural similarities to known psychoactive substances. Its properties, such as melting point, boiling point, and solubility, would typically be determined through experimental methods and may vary based on the specific conditions of the study.
Formula:C14H22ClNO
InChI:InChI=1/C14H21NO.ClH/c1-2-8-15-9-4-6-13(11-15)12-5-3-7-14(16)10-12;/h3,5,7,10,13,16H,2,4,6,8-9,11H2,1H3;1H/t13-;/m0./s1
SMILES:CCCN1CCC[C@@H](C1)c1cccc(c1)O.Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
(R)-Preclamol hydrochloride
CAS:(R)-Preclamol HCl is a dopamine agonist stimulating both auto and postsynaptic receptors.Formula:C14H22ClNOColor and Shape:SolidMolecular weight:255.78R(+)-3-(3-Hydroxyphenyl)-N-propylpiperidine hydrochloride
CAS:Formula:C14H21NO·HClMolecular weight:255.78

