CymitQuimica logo

CAS 898746-42-4

:

6-Fluoro-1H-pyrrolo[2,3-b]pyridine

Description:
6-Fluoro-1H-pyrrolo[2,3-b]pyridine is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a fluorine atom at the 6-position enhances its reactivity and can influence its biological activity, making it of interest in medicinal chemistry. This compound typically exhibits a planar structure, which can facilitate interactions with biological targets. It is often synthesized through various organic reactions, including cyclization methods. The compound's solubility and stability can vary depending on the solvent and conditions used. Additionally, 6-Fluoro-1H-pyrrolo[2,3-b]pyridine may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. Its CAS number, 898746-42-4, is a unique identifier that aids in the cataloging and retrieval of information related to this specific chemical substance in scientific literature and databases. Overall, this compound represents a valuable structure in the field of organic and medicinal chemistry.
Formula:C7H5FN2
InChI:InChI=1/C7H5FN2/c8-6-2-1-5-3-4-9-7(5)10-6/h1-4H,(H,9,10)
InChI key:InChIKey=ZALXIVQPEUDQPO-UHFFFAOYSA-N
SMILES:FC=1N=C2C(=CC1)C=CN2
Synonyms:
  • 1H-pyrrolo[2,3-b]pyridine, 6-fluoro-
  • 6-Fluor-1H-pyrrolo[2,3-b]pyridin
  • 6-Fluoro-7-azaindole
  • 6-Fluoro-1H-pyrrolo[2,3-b]pyridine
  • EOS-60627
Found 4 products.