CAS 898747-00-7

6-Bromo-1H-indazole-4-carbonitrile

Description:

6-Bromo-1H-indazole-4-carbonitrile is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. The presence of a bromine atom at the 6-position and a cyano group (-C≡N) at the 4-position contributes to its unique reactivity and properties. This compound is typically a solid at room temperature and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with biological targets. The cyano group enhances its electrophilic character, making it useful in various chemical reactions, including nucleophilic substitutions. Additionally, the bromine substituent can serve as a site for further functionalization, allowing for the synthesis of more complex molecules. Its molecular structure and functional groups suggest that it may exhibit interesting biological activities, warranting further investigation in drug discovery and development. As with many synthetic compounds, proper handling and safety measures should be observed due to potential toxicity and reactivity.

Formula: C₈H₄BrN₃

InChI: InChI=1S/C8H4BrN3/c9-6-1-5(3-10)7-4-11-12-8(7)2-6/h1-2,4H,(H,11,12)

InChI key: InChIKey=ILGPSFSWRANYDT-UHFFFAOYSA-N

SMILES: C(#N)C1=C2C(=CC(Br)=C1)NN=C2

Synonyms:

• 6-Bromo-1H-indazole-4-carbonitrile
• 1H-Indazole-4-carbonitrile, 6-bromo-

6-Bromo-1H-indazole-4-carbonitrile

CAS: 898747-00-7

Formula: C₈H₄BrN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 222.0415

Ref: IN-DA00H01X

6-Bromo-1H-indazole-4-carbonitrile

CAS: 898747-00-7

6-Bromo-1H-indazole-4-carbonitrile

Purity: 96%

Molecular weight: 222.04g/mol

Ref: 54-OR76308

6-Bromo-1H-indazole-4-carbonitrile

CAS: 898747-00-7

Formula: C₈H₄BrN₃

Purity: 96%

Color and Shape: Solid

Molecular weight: 222.045

Ref: 10-F220140