CAS 898747-62-1
:3-(2-ethoxyethoxy)benzoic acid
Description:
3-(2-Ethoxyethoxy)benzoic acid is an organic compound characterized by its benzoic acid structure, which features a carboxylic acid functional group (-COOH) attached to a benzene ring. The compound includes an ethoxyethoxy substituent at the meta position relative to the carboxylic acid group. This ethoxyethoxy group contributes to the compound's solubility and polarity, making it more hydrophilic compared to simpler benzoic acids. The presence of the ether linkages in the substituent can also influence the compound's reactivity and interactions with other molecules. Typically, compounds like this may exhibit properties such as moderate melting and boiling points, and they may participate in hydrogen bonding due to the carboxylic acid group. Additionally, the compound may have applications in various fields, including pharmaceuticals and materials science, due to its unique structural features. As with many organic compounds, safety and handling precautions should be observed, as they may pose health risks or environmental hazards.
Formula:C11H14O4
InChI:InChI=1/C11H14O4/c1-2-14-6-7-15-10-5-3-4-9(8-10)11(12)13/h3-5,8H,2,6-7H2,1H3,(H,12,13)
SMILES:CCOCCOc1cccc(c1)C(=O)O
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
