CAS 898748-39-5

2-Bromo-6-(1,1-dimethylethyl)benzothiazole

Description:

2-Bromo-6-(1,1-dimethylethyl)benzothiazole is an organic compound characterized by its unique structure, which includes a benzothiazole ring substituted with a bromine atom and a tert-butyl group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, including stability and potential reactivity due to the presence of the bromine substituent. The tert-butyl group contributes to its hydrophobic nature, influencing its solubility in organic solvents rather than in water. The presence of the benzothiazole moiety suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis. Additionally, compounds like this may exhibit biological activity, making them of interest in medicinal chemistry. Safety data should be consulted for handling and usage, as halogenated compounds can pose environmental and health risks. Overall, 2-Bromo-6-(1,1-dimethylethyl)benzothiazole represents a versatile compound with potential applications in various chemical fields.

Formula: C₁₁H₁₂BrNS

InChI: InChI=1S/C11H12BrNS/c1-11(2,3)7-4-5-8-9(6-7)14-10(12)13-8/h4-6H,1-3H3

InChI key: InChIKey=PRXGVHNJTZGGOO-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C=1C=C2C(=CC1)N=C(Br)S2

Synonyms:

• 2-Bromo-6-(1,1-dimethylethyl)benzothiazole
• Benzothiazole, 2-bromo-6-(1,1-dimethylethyl)-

2-Bromo-6-(1,1-dimethylethyl)benzothiazole

CAS: 898748-39-5

Versatile small molecule scaffold

Formula: C₁₁H₁₂BrNS

Purity: Min. 95%

Molecular weight: 270.19 g/mol

Ref: 3D-YKB74839