CAS 898749-15-0

Methanone, (3-chloro-4-fluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3-chloro-4-fluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its chemical reactivity and potential biological activity. The compound features a pyrrolidine moiety, which may influence its pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, possibly leading to applications in drug development. The compound's solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Additionally, the presence of halogen atoms typically enhances lipophilicity, which can affect the compound's bioavailability and distribution in biological systems. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical properties, making it a subject of interest for further research in various fields, including pharmaceuticals and materials science.

Formula: C₁₈H₁₅ClFNO

InChI: InChI=1/C18H15ClFNO/c19-16-11-15(6-7-17(16)20)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h1-7,10-11H,8-9,12H2

InChI key: InChIKey=JIKPOGKTUAGJKZ-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=CC(Cl)=C(F)C=C3

Synonyms:

• (3-Chloro-4-fluorophenyl)[3-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (3-chloro-4-fluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

3-chloro-4-fluoro-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898749-15-0

Purity: 97.0%

Molecular weight: 315.77

Ref: 10-F205083