CAS 898749-19-4

(2-chlorophenyl)-[3-(2,5-dihydropyrrol-1-ylmethyl)phenyl]methanone

Description:

The chemical substance known as (2-chlorophenyl)-[3-(2,5-dihydropyrrol-1-ylmethyl)phenyl]methanone, with the CAS number 898749-19-4, is a synthetic organic compound characterized by its complex structure that includes a chlorophenyl group and a dihydropyrrol moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, which may influence its reactivity and interactions. It is likely to be a solid at room temperature, with potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its unique structural features. The presence of the chlorophenyl group may impart specific electronic properties, while the dihydropyrrol moiety could contribute to biological activity. As with many organic compounds, its solubility, melting point, and stability can vary based on environmental conditions and the presence of solvents. Safety data and handling precautions should be consulted, as with any chemical substance, to ensure proper usage and risk management in laboratory settings.

Formula: C₁₈H₁₆ClNO

InChI: InChI=1/C18H16ClNO/c19-17-9-2-1-8-16(17)18(21)15-7-5-6-14(12-15)13-20-10-3-4-11-20/h1-9,12H,10-11,13H2

SMILES: c1ccc(c(c1)C(=O)c1cccc(c1)CN1CC=CC1)Cl

2-chloro-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898749-19-4

Purity: 97.0%

Molecular weight: 297.78

Ref: 10-F205084