CAS 898749-41-2

Methanone, (3-chloro-5-fluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3-chloro-5-fluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of chlorine and fluorine substituents on the phenyl rings contributes to its chemical reactivity and potential biological activity. The compound features a pyrrolidine moiety, which may influence its pharmacological properties, making it of interest in medicinal chemistry. Its molecular design suggests potential applications in drug development, particularly in targeting specific biological pathways. The compound's solubility, stability, and reactivity can vary based on environmental conditions and the presence of other chemical species. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies, including spectroscopic analysis and biological assays, would be necessary to fully elucidate its properties and potential applications in various fields, including pharmaceuticals and agrochemicals.

Formula: C₁₈H₁₅ClFNO

InChI: InChI=1S/C18H15ClFNO/c19-16-9-15(10-17(20)11-16)18(22)14-5-3-4-13(8-14)12-21-6-1-2-7-21/h1-5,8-11H,6-7,12H2

InChI key: InChIKey=AOLRLNQNNYUKCD-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(Cl)=CC(F)=C1)C2=CC(CN3CC=CC3)=CC=C2

Synonyms:

• (3-Chloro-5-fluorophenyl)[3-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (3-chloro-5-fluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

3-chloro-5-fluoro-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898749-41-2

Purity: 97.0%

Molecular weight: 315.77

Ref: 10-F205091