CAS 898749-47-8

Methanone, (2,3-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (2,3-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl and pyrrol moieties contributes to its chemical reactivity and potential biological activity. This compound is likely to exhibit properties typical of both aromatic and heterocyclic compounds, such as stability and the ability to participate in various chemical reactions, including electrophilic substitutions. The dichlorophenyl group may enhance lipophilicity, influencing its solubility and interaction with biological systems. Additionally, the pyrrol ring suggests potential for interactions with biological targets, making it of interest in medicinal chemistry. Its molecular structure indicates potential applications in pharmaceuticals or agrochemicals, although specific biological activities would require empirical investigation. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.

Formula: C₁₈H₁₅Cl₂NO

InChI: InChI=1S/C18H15Cl2NO/c19-16-8-4-7-15(17(16)20)18(22)14-6-3-5-13(11-14)12-21-9-1-2-10-21/h1-8,11H,9-10,12H2

InChI key: InChIKey=NMVVPXWVALWAPB-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=C(Cl)C(Cl)=CC=C3

Synonyms:

• (2,3-Dichlorophenyl)[3-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (2,3-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

2,3-dichloro-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898749-47-8

Purity: 97.0%

Molecular weight: 332.22

Ref: 10-F205093