CAS 898749-52-5

Methanone, (2,5-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (2,5-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique molecular structure, which includes a methanone functional group and multiple aromatic rings. The presence of dichlorophenyl and pyrrol moieties suggests that it may exhibit interesting electronic properties and potential biological activity. Typically, compounds of this nature can be evaluated for their solubility, stability, and reactivity under various conditions. The dichlorophenyl group may enhance lipophilicity, while the pyrrol ring could contribute to potential interactions with biological targets. Such compounds are often studied for their pharmacological properties, including potential as pharmaceuticals or agrochemicals. The specific arrangement of substituents can significantly influence the compound's behavior in chemical reactions and its interactions with other molecules. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies, including spectroscopic analysis and biological assays, would be necessary to fully elucidate its properties and applications.

Formula: C₁₈H₁₅Cl₂NO

InChI: InChI=1/C18H15Cl2NO/c19-15-6-7-17(20)16(11-15)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h1-7,10-11H,8-9,12H2

InChI key: InChIKey=OIQBVPXZYNBFQV-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=C(Cl)C=CC(Cl)=C3

Synonyms:

• (2,5-Dichlorophenyl)[3-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (2,5-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

2,5-dichloro-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898749-52-5

Purity: 97.0%

Molecular weight: 332.22

Ref: 10-F205095