CAS 898749-54-7

Methanone, (3,4-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (3,4-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is a complex organic compound characterized by its unique structural features. It contains a methanone functional group, which is indicative of a ketone, and is substituted with a 3,4-dichlorophenyl group, contributing to its potential reactivity and biological activity. The presence of a pyrrolidine moiety suggests that the compound may exhibit interesting pharmacological properties, as pyrrolidine derivatives are often associated with various biological activities. The compound's molecular structure includes multiple aromatic rings, which can enhance its stability and influence its interactions with biological targets. Additionally, the chlorinated phenyl group may affect the compound's lipophilicity and solubility, impacting its behavior in biological systems. Overall, this compound's unique combination of functional groups and structural elements makes it a subject of interest in medicinal chemistry and drug development, particularly in the search for new therapeutic agents.

Formula: C₁₈H₁₅Cl₂NO

InChI: InChI=1/C18H15Cl2NO/c19-16-7-6-15(11-17(16)20)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h1-7,10-11H,8-9,12H2

InChI key: InChIKey=DPKLXXPVYTVVDX-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3=CC(Cl)=C(Cl)C=C3

Synonyms:

• (3,4-Dichlorophenyl)[3-(2,5-dihydro-1H-pyrrol-1-ylmethyl)phenyl]methanone
• Methanone, (3,4-dichlorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

3,4-dichloro-3'-(3-pyrrolinomethyl) benzophenone

CAS: 898749-54-7

Purity: 97.0%

Molecular weight: 332.22

Ref: 10-F205096