CAS 898749-58-1

Methanone, (2,4-difluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Description:

Methanone, (2,4-difluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of difluorophenyl groups indicates that the compound has fluorine substituents, which can influence its reactivity and physical properties, such as polarity and boiling point. The pyrrolidine moiety suggests potential for biological activity, as many compounds containing nitrogen heterocycles exhibit pharmacological properties. This compound may be of interest in medicinal chemistry, particularly in the development of pharmaceuticals, due to its unique structural features. Its molecular interactions, solubility, and stability would be influenced by the arrangement of its functional groups and the presence of fluorine atoms, which can enhance lipophilicity and alter electronic properties. As with many organic compounds, safety and handling precautions are essential, especially considering the potential toxicity associated with fluorinated compounds. Further studies would be necessary to fully elucidate its properties and potential applications.

Formula: C₁₈H₁₅F₂NO

InChI: InChI=1S/C18H15F2NO/c19-15-6-7-16(17(20)11-15)18(22)14-5-3-4-13(10-14)12-21-8-1-2-9-21/h1-7,10-11H,8-9,12H2

InChI key: InChIKey=NHHKKKLKNJVPGJ-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(F)C=C(F)C=C1)C2=CC(CN3CC=CC3)=CC=C2

Synonyms:

• Methanone, (2,4-difluorophenyl)[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

2,4-difluoro-3′-(3-pyrrolinomethyl) benzophenone

CAS: 898749-58-1

Formula: C₁₈H₁₅F₂NO

Purity: 97.0%

Molecular weight: 299.321

Ref: 10-F205098