CAS 898749-66-1

cyclopropyl-[3-(2,5-dihydropyrrol-1-ylmethyl)phenyl]methanone

Description:

Cyclopropyl-[3-(2,5-dihydropyrrol-1-ylmethyl)phenyl]methanone, identified by its CAS number 898749-66-1, is a chemical compound characterized by its unique structural features. It contains a cyclopropyl group, which is a three-membered carbon ring known for its strain and reactivity. The compound also features a phenyl ring substituted at the 3-position with a 2,5-dihydropyrrol-1-ylmethyl group, indicating the presence of a nitrogen-containing heterocycle that contributes to its potential biological activity. The methanone functional group suggests the presence of a carbonyl (C=O) moiety, which is often involved in various chemical reactions, including nucleophilic attacks and condensation reactions. This compound may exhibit interesting pharmacological properties due to its structural complexity, making it a candidate for further research in medicinal chemistry. Its specific characteristics, such as solubility, stability, and reactivity, would depend on the surrounding conditions and the presence of other functional groups in the molecule.

Formula: C₁₅H₁₇NO

InChI: InChI=1/C15H17NO/c17-15(13-6-7-13)14-5-3-4-12(10-14)11-16-8-1-2-9-16/h1-5,10,13H,6-9,11H2

SMILES: C1=CCN(C1)Cc1cccc(c1)C(=O)C1CC1

Cyclopropyl 3-(3-pyrrolinomethyl)phenyl ketone

CAS: 898749-66-1

Purity: 97.0%

Molecular weight: 227.307

Ref: 10-F205102