CAS 898749-69-4

Cyclobutyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Description:

Cyclobutyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone, with the CAS number 898749-69-4, is a synthetic organic compound characterized by its unique structural features. It contains a cyclobutyl group, which is a four-membered carbon ring, and a phenyl ring substituted with a pyrrolidine moiety. The presence of the methanone functional group indicates that it is a ketone, contributing to its reactivity and potential applications in organic synthesis. This compound may exhibit interesting biological activities due to the presence of the pyrrolidine ring, which is often associated with various pharmacological properties. Its molecular structure suggests potential interactions with biological targets, making it a candidate for further research in medicinal chemistry. Additionally, the compound's solubility, stability, and reactivity would depend on the specific conditions under which it is handled, including solvent choice and temperature. Overall, Cyclobutyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone represents a complex organic molecule with potential utility in various chemical and pharmaceutical applications.

Formula: C₁₆H₁₉NO

InChI: InChI=1S/C16H19NO/c18-16(14-6-4-7-14)15-8-3-5-13(11-15)12-17-9-1-2-10-17/h1-3,5,8,11,14H,4,6-7,9-10,12H2

InChI key: InChIKey=FCWHNHOEALYDTE-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3CCC3

Synonyms:

• Cyclobutyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone
• Methanone, cyclobutyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Cyclobutyl 3-(3-pyrrolinomethyl)phenyl ketone

CAS: 898749-69-4

Purity: 97.0%

Molecular weight: 241.334

Ref: 10-F205103