CAS 898749-72-9

Cyclopentyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone

Description:

Cyclopentyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone, with the CAS number 898749-72-9, is a synthetic organic compound characterized by its complex molecular structure. It features a cyclopentyl group, which is a five-membered carbon ring, and a phenyl group attached to a ketone functional group (methanone). The presence of a pyrrolidine moiety indicates that it contains a five-membered nitrogen-containing ring, contributing to its potential biological activity. This compound may exhibit properties such as lipophilicity due to its hydrophobic cyclopentyl and phenyl groups, which can influence its solubility and interaction with biological membranes. Additionally, the presence of the pyrrolidine ring suggests potential for interactions with neurotransmitter systems, making it of interest in medicinal chemistry. Its synthesis and characterization would typically involve standard organic reactions, and it may be evaluated for various applications, including pharmaceutical development. As with many synthetic compounds, safety and handling precautions are essential due to potential toxicity or reactivity.

Formula: C₁₇H₂₁NO

InChI: InChI=1S/C17H21NO/c19-17(15-7-1-2-8-15)16-9-5-6-14(12-16)13-18-10-3-4-11-18/h3-6,9,12,15H,1-2,7-8,10-11,13H2

InChI key: InChIKey=NAHHKDMQPXBEKA-UHFFFAOYSA-N

SMILES: C(=O)(C1=CC(CN2CC=CC2)=CC=C1)C3CCCC3

Synonyms:

• Cyclopentyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]methanone
• Methanone, cyclopentyl[3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]phenyl]-

Cyclopentyl 3-(3-pyrrolinomethyl)phenyl ketone

CAS: 898749-72-9

Purity: 97.0%

Molecular weight: 255.361

Ref: 10-F205104