CAS 898749-78-5

Ethyl 3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]-δ-oxobenzenepentanoate

Description:

Ethyl 3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]-δ-oxobenzenepentanoate, identified by its CAS number 898749-78-5, is a chemical compound that features a complex structure combining an ethyl ester with a pyrrole moiety. This compound typically exhibits characteristics associated with both esters and nitrogen-containing heterocycles. The presence of the ethyl group suggests it may have moderate volatility and solubility in organic solvents, while the pyrrole ring can impart unique reactivity and potential biological activity. The δ-oxobenzenepentanoate structure indicates that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Additionally, the compound may exhibit specific pharmacological properties due to the pyrrole component, which is often associated with diverse biological activities. Overall, this compound's unique structure may make it of interest in fields such as medicinal chemistry and materials science, although specific applications would depend on further research and characterization.

Formula: C₁₈H₂₃NO₃

InChI: InChI=1S/C18H23NO3/c1-2-22-18(21)10-6-9-17(20)16-8-5-7-15(13-16)14-19-11-3-4-12-19/h3-5,7-8,13H,2,6,9-12,14H2,1H3

InChI key: InChIKey=KBOUJKGDRSPHJV-UHFFFAOYSA-N

SMILES: C(C1=CC(C(CCCC(OCC)=O)=O)=CC=C1)N2CC=CC2

Synonyms:

• Benzenepentanoic acid, 3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]-δ-oxo-, ethyl ester
• Ethyl 3-[(2,5-dihydro-1H-pyrrol-1-yl)methyl]-δ-oxobenzenepentanoate

Ethyl 5-oxo-5-[3-(3-pyrrolinomethyl)phenyl]valerate

CAS: 898749-78-5

Formula: C₁₈H₂₃NO₃

Purity: 97.0%

Molecular weight: 301.386

Ref: 10-F205107