CAS 898749-86-5

1-Propanone, 1-(2,6-dichlorophenyl)-3-[2-(trifluoromethyl)phenyl]-

Description:

1-Propanone, 1-(2,6-dichlorophenyl)-3-[2-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a trifluoromethylphenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. It may exhibit moderate to high stability under standard conditions but could be sensitive to strong oxidizing agents. Additionally, due to the presence of halogen substituents, it may have specific reactivity patterns, making it of interest in various chemical syntheses or pharmaceutical applications. Safety data should be consulted for handling, as halogenated compounds can pose environmental and health risks.

Formula: C₁₆H₁₁Cl₂F₃O

InChI: InChI=1S/C16H11Cl2F3O/c17-12-6-3-7-13(18)15(12)14(22)9-8-10-4-1-2-5-11(10)16(19,20)21/h1-7H,8-9H2

InChI key: InChIKey=PMFUIGHJIMRBGT-UHFFFAOYSA-N

SMILES: C(CC(=O)C1=C(Cl)C=CC=C1Cl)C2=C(C(F)(F)F)C=CC=C2

Synonyms:

• 2′,6′-Dichloro-3-(2-trifluoromethylphenyl)-propiophenone
• 1-Propanone, 1-(2,6-dichlorophenyl)-3-[2-(trifluoromethyl)phenyl]-
• 1-(2,6-Dichlorophenyl)-3-[2-(trifluoromethyl)phenyl]-1-propanone

2′,6′-dichloro-3-(2-trifluoromethylphenyl)propiophenone

CAS: 898749-86-5

Formula: C₁₆H₁₁Cl₂F₃O

Purity: 97.0%

Molecular weight: 347.16

Ref: 10-F206679