CymitQuimica logo

CAS 898749-89-8

:

1-Propanone, 1-(2,6-dichlorophenyl)-3-[3-(trifluoromethyl)phenyl]-

Description:
1-Propanone, 1-(2,6-dichlorophenyl)-3-[3-(trifluoromethyl)phenyl]- is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a dichlorophenyl group and a trifluoromethylphenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its unique chemical properties, including increased lipophilicity and potential biological activity. The compound is likely to be a solid or liquid at room temperature, depending on its molecular weight and structure. It may exhibit moderate to high stability under standard conditions but could be sensitive to light or heat. Additionally, due to the presence of halogen atoms, it may have specific reactivity patterns, such as electrophilic substitution. Safety data sheets should be consulted for handling and toxicity information, as halogenated compounds can pose environmental and health risks. Overall, this compound's unique structure suggests potential applications in pharmaceuticals or agrochemicals, warranting further investigation.
Formula:C16H11Cl2F3O
InChI:InChI=1S/C16H11Cl2F3O/c17-12-5-2-6-13(18)15(12)14(22)8-7-10-3-1-4-11(9-10)16(19,20)21/h1-6,9H,7-8H2
InChI key:InChIKey=VMMVSCMQTOVCHG-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=C(Cl)C=CC=C1Cl)C2=CC(C(F)(F)F)=CC=C2
Synonyms:
  • 1-(2,6-Dichlorophenyl)-3-[3-(trifluoromethyl)phenyl]-1-propanone
  • 2′,6′-Dichloro-3-(3-trifluoromethylphenyl)-propiophenone
  • 1-Propanone, 1-(2,6-dichlorophenyl)-3-[3-(trifluoromethyl)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.