CAS 898749-93-4

Methanone, (4-methylphenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-methylphenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of a 4-methylphenyl group and a morpholinylmethyl substituent indicates that this compound has both hydrophobic and hydrophilic characteristics, potentially influencing its solubility and reactivity. The morpholine ring contributes to the compound's basicity and may participate in hydrogen bonding, affecting its interactions in biological systems. This compound is likely to exhibit moderate stability under standard conditions, but its reactivity can be influenced by the substituents on the aromatic rings. Methanone derivatives often find applications in pharmaceuticals and agrochemicals due to their ability to interact with biological targets. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, the unique combination of functional groups in this compound suggests potential utility in various chemical applications, particularly in medicinal chemistry.

Formula: C₁₉H₂₁NO₂

InChI: InChI=1S/C19H21NO2/c1-15-6-8-16(9-7-15)19(21)18-5-3-2-4-17(18)14-20-10-12-22-13-11-20/h2-9H,10-14H2,1H3

InChI key: InChIKey=RQORBKHVXBKMRF-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=CC=C(C)C=C3

Synonyms:

• Methanone, (4-methylphenyl)[2-(4-morpholinylmethyl)phenyl]-
• (4-Methylphenyl)[2-(4-morpholinylmethyl)phenyl]methanone

4′-Methyl-2-morpholinomethyl benzophenone

CAS: 898749-93-4

Formula: C₁₉H₂₁NO₂

Purity: 97.0%

Molecular weight: 295.382

Ref: 10-F205114