CAS 898749-96-7

Methanone, (2-methoxyphenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2-methoxyphenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two aromatic rings. The presence of a methoxy group (–OCH3) on one of the phenyl rings enhances its solubility in organic solvents and may influence its reactivity and interaction with biological systems. The morpholine moiety introduces a cyclic amine, which can contribute to the compound's pharmacological properties, potentially enhancing its ability to interact with biological targets. This compound may exhibit various chemical properties, including stability under standard conditions, and it may participate in typical organic reactions such as nucleophilic substitutions or electrophilic aromatic substitutions. Its specific applications and biological activity would depend on its interaction with various receptors or enzymes, making it of interest in medicinal chemistry and drug development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₉H₂₁NO₃

InChI: InChI=1/C19H21NO3/c1-22-18-9-5-4-8-17(18)19(21)16-7-3-2-6-15(16)14-20-10-12-23-13-11-20/h2-9H,10-14H2,1H3

InChI key: InChIKey=PWSUJBQYISDSET-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=C(OC)C=CC=C3

Synonyms:

• (2-Methoxyphenyl)[2-(4-morpholinylmethyl)phenyl]methanone
• Methanone, (2-methoxyphenyl)[2-(4-morpholinylmethyl)phenyl]-
• 2-Methoxy-2′-morpholinomethyl benzophenone

2-Methoxy-2′-morpholinomethyl benzophenone

CAS: 898749-96-7

Formula: C₁₉H₂₁NO₃

Purity: 97.0%

Molecular weight: 311.381

Ref: 10-F205115