CAS 898750-01-1
:3-(3-chloro-5-fluoro-phenyl)-1-phenyl-propan-1-one
Description:
3-(3-Chloro-5-fluoro-phenyl)-1-phenyl-propan-1-one, identified by its CAS number 898750-01-1, is an organic compound characterized by its ketone functional group. It features a propanone backbone with a phenyl group and a substituted aromatic ring that includes both chlorine and fluorine atoms. The presence of these halogens typically influences the compound's reactivity, polarity, and potential biological activity. The chlorofluorophenyl substituent can enhance lipophilicity, which may affect its solubility in organic solvents and its interaction with biological systems. This compound may be of interest in medicinal chemistry and material science due to its structural features, which could impart specific pharmacological properties or utility in synthesis. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the halogen substituents, making it a candidate for further study in various chemical applications. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C15H12ClFO
InChI:InChI=1/C15H12ClFO/c16-13-8-11(9-14(17)10-13)6-7-15(18)12-4-2-1-3-5-12/h1-5,8-10H,6-7H2
SMILES:c1ccc(cc1)C(=O)CCc1cc(cc(c1)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.