CAS 898750-02-2

(4-methoxyphenyl)-[2-(morpholinomethyl)phenyl]methanone

Description:

(4-methoxyphenyl)-[2-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898750-02-2, is a synthetic organic compound characterized by its complex structure, which includes a methanone functional group and a morpholine moiety. This compound typically exhibits properties associated with aromatic ketones, such as moderate to high stability under standard conditions and potential solubility in organic solvents. The presence of the methoxy group enhances its electron-donating characteristics, which can influence its reactivity and interaction with biological systems. Morpholine, a cyclic amine, contributes to the compound's potential biological activity, possibly enhancing its ability to interact with various receptors or enzymes. As with many organic compounds, its physical properties, such as melting point, boiling point, and solubility, can vary based on environmental conditions and the presence of other substances. This compound may be of interest in pharmaceutical research, particularly in the development of new therapeutic agents, due to its structural features that could facilitate specific biological interactions.

Formula: C₁₉H₂₁NO₃

InChI: InChI=1/C19H21NO3/c1-22-17-8-6-15(7-9-17)19(21)18-5-3-2-4-16(18)14-20-10-12-23-13-11-20/h2-9H,10-14H2,1H3

SMILES: COc1ccc(cc1)C(=O)c1ccccc1CN1CCOCC1

Synonyms:

• 4'-METHOXY-2-MORPHOLINOMETHYL BENZOPHENONE
• Methanone, (4-methoxyphenyl)[2-(4-morpholinylmethyl)phenyl]-

4′-Methoxy-2-morpholinomethyl benzophenone

CAS: 898750-02-2

Formula: C₁₉H₂₁NO₃

Purity: 97.0%

Molecular weight: 311.381

Ref: 10-F205117