CAS 898750-05-5

2-[2-(morpholinomethyl)benzoyl]benzonitrile

Description:

2-[2-(Morpholinomethyl)benzoyl]benzonitrile, identified by its CAS number 898750-05-5, is a chemical compound that features a complex structure incorporating both a benzoyl group and a benzonitrile moiety. This compound is characterized by the presence of a morpholine ring, which contributes to its potential biological activity and solubility properties. The morpholinomethyl group enhances the compound's ability to interact with biological targets, making it of interest in medicinal chemistry. The presence of the nitrile functional group (–C≡N) suggests potential reactivity and the ability to participate in various chemical reactions, including nucleophilic additions. Additionally, the compound's aromatic rings may provide stability and influence its electronic properties. Overall, 2-[2-(morpholinomethyl)benzoyl]benzonitrile is a synthetic organic compound that may exhibit interesting pharmacological properties, warranting further investigation in drug development and related fields.

Formula: C₁₉H₁₈N₂O₂

InChI: InChI=1/C19H18N2O2/c20-13-15-5-1-3-7-17(15)19(22)18-8-4-2-6-16(18)14-21-9-11-23-12-10-21/h1-8H,9-12,14H2

SMILES: c1ccc(c(c1)C#N)C(=O)c1ccccc1CN1CCOCC1

2-Cyano-2′-morpholinomethyl benzophenone

CAS: 898750-05-5

Formula: C₁₉H₁₈N₂O₂

Purity: 97.0%

Molecular weight: 306.365

Ref: 10-F205118