CAS 898750-08-8

3-[2-(4-Morpholinylmethyl)benzoyl]benzonitrile

Description:

3-[2-(4-Morpholinylmethyl)benzoyl]benzonitrile, with the CAS number 898750-08-8, is a synthetic organic compound characterized by its complex structure, which includes a benzoyl group and a morpholine moiety. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity due to the presence of the morpholine ring, which is known for its role in medicinal chemistry. The presence of the benzonitrile group suggests that it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound may exhibit specific interactions with biological targets, making it of interest in pharmaceutical research. Its molecular structure allows for potential applications in drug development, particularly in the design of compounds with targeted therapeutic effects. As with many synthetic organic compounds, safety and handling precautions should be observed, as the biological activity and toxicity profile would need to be thoroughly evaluated in a laboratory setting.

Formula: C₁₉H₁₈N₂O₂

InChI: InChI=1S/C19H18N2O2/c20-13-15-4-3-6-16(12-15)19(22)18-7-2-1-5-17(18)14-21-8-10-23-11-9-21/h1-7,12H,8-11,14H2

InChI key: InChIKey=VMMLDWPGQWRSSM-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(C#N)=CC=C2)C=CC=C1)N3CCOCC3

Synonyms:

• Benzonitrile, 3-[2-(4-morpholinylmethyl)benzoyl]-
• 3-[2-(4-Morpholinylmethyl)benzoyl]benzonitrile

3′-Cyano-2-morpholinomethyl benzophenone

CAS: 898750-08-8

Formula: C₁₉H₁₈N₂O₂

Purity: 97.0%

Molecular weight: 306.365

Ref: 10-F205119