CAS 898750-11-3

4-[2-(4-Morpholinylmethyl)benzoyl]benzonitrile

Description:

4-[2-(4-Morpholinylmethyl)benzoyl]benzonitrile, identified by its CAS number 898750-11-3, is a chemical compound characterized by its complex structure, which includes a benzoyl group and a morpholine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential applications in medicinal chemistry. The presence of the morpholine ring suggests it may possess basic properties, which can influence its solubility and reactivity. Additionally, the benzonitrile component indicates that it may participate in nucleophilic reactions due to the presence of the cyano group. This compound may be of interest in pharmaceutical research, particularly in the development of therapeutic agents, owing to its structural features that could interact with biological targets. Its synthesis and characterization would involve standard organic chemistry techniques, and its behavior in biological systems would require further investigation to determine its efficacy and safety profiles.

Formula: C₁₉H₁₈N₂O₂

InChI: InChI=1S/C19H18N2O2/c20-13-15-5-7-16(8-6-15)19(22)18-4-2-1-3-17(18)14-21-9-11-23-12-10-21/h1-8H,9-12,14H2

InChI key: InChIKey=NADLHSDWIZMPLS-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC=C(C#N)C=C2)C=CC=C1)N3CCOCC3

Synonyms:

• Benzonitrile, 4-[2-(4-morpholinylmethyl)benzoyl]-
• 4-[2-(4-Morpholinylmethyl)benzoyl]benzonitrile

4′-Cyano-2-morpholinomethyl benzophenone

CAS: 898750-11-3

Formula: C₁₉H₁₈N₂O₂

Purity: 97.0%

Molecular weight: 306.365

Ref: 10-F205120