CAS 898750-13-5

1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2-methoxyphenyl)-

Description:

1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2-methoxyphenyl)-, with the CAS number 898750-13-5, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone substituted with a 3-chloro-5-fluorophenyl group and a 2-methoxyphenyl group, contributing to its unique chemical properties. The presence of halogen atoms, such as chlorine and fluorine, typically enhances the compound's reactivity and may influence its biological activity. The methoxy group can also affect solubility and polarity, making the compound potentially useful in various applications, including pharmaceuticals and agrochemicals. In terms of physical properties, compounds of this nature often exhibit moderate to high boiling points and may be soluble in organic solvents. The specific reactivity and stability of this compound would depend on its molecular interactions and the environment in which it is used. Overall, this compound represents a complex structure with potential applications in medicinal chemistry and material science.

Formula: C₁₆H₁₄ClFO₂

InChI: InChI=1S/C16H14ClFO2/c1-20-16-5-3-2-4-14(16)15(19)7-6-11-8-12(17)10-13(18)9-11/h2-5,8-10H,6-7H2,1H3

InChI key: InChIKey=BZXQIESLOKSGPK-UHFFFAOYSA-N

SMILES: C(CCC1=CC(Cl)=CC(F)=C1)(=O)C2=C(OC)C=CC=C2

Synonyms:

• 3-(3-Chloro-5-fluorophenyl)-2′-methoxypropiophenone
• 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(2-methoxyphenyl)-
• 3-(3-Chloro-5-fluorophenyl)-1-(2-methoxyphenyl)-1-propanone