CAS 898750-14-6
:ethyl 2-[2-(morpholinomethyl)benzoyl]benzoate
Description:
Ethyl 2-[2-(morpholinomethyl)benzoyl]benzoate, identified by its CAS number 898750-14-6, is an organic compound characterized by its complex structure, which includes an ethyl ester group and a morpholinomethyl substituent attached to a benzoyl moiety. This compound typically exhibits properties associated with esters, such as being a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is likely to be soluble in organic solvents, while its solubility in water may be limited due to the presence of hydrophobic aromatic rings. Ethyl 2-[2-(morpholinomethyl)benzoyl]benzoate may possess biological activity, making it of interest in pharmaceutical research, particularly in the development of drug candidates. Its morpholine ring suggests potential interactions with biological targets, which could be explored in medicinal chemistry. As with many organic compounds, safety data should be consulted for handling and usage, as it may pose risks such as irritation or toxicity.
Formula:C21H23NO4
InChI:InChI=1/C21H23NO4/c1-2-26-21(24)19-10-6-5-9-18(19)20(23)17-8-4-3-7-16(17)15-22-11-13-25-14-12-22/h3-10H,2,11-15H2,1H3
SMILES:CCOC(=O)c1ccccc1C(=O)c1ccccc1CN1CCOCC1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.