CAS 898750-16-8

3-(3-chloro-5-fluoro-phenyl)-1-(3-methoxyphenyl)propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-(3-methoxyphenyl)propan-1-one, with the CAS number 898750-16-8, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with aromatic groups. The presence of a chloro and a fluoro substituent on one phenyl ring contributes to its potential reactivity and biological activity, while the methoxy group on the other phenyl ring can influence its solubility and electronic properties. This compound is likely to exhibit properties typical of ketones, such as being a polar solvent and participating in nucleophilic addition reactions. Its unique substituents may also impart specific pharmacological activities, making it of interest in medicinal chemistry. The compound's molecular structure suggests it could be involved in various chemical reactions, including electrophilic aromatic substitution and reduction processes. Overall, its characteristics make it a subject of interest for further research in fields such as drug development and organic synthesis.

Formula: C₁₆H₁₄ClFO₂

InChI: InChI=1/C16H14ClFO2/c1-20-15-4-2-3-12(9-15)16(19)6-5-11-7-13(17)10-14(18)8-11/h2-4,7-10H,5-6H2,1H3

SMILES: COc1cccc(c1)C(=O)CCc1cc(cc(c1)F)Cl

Synonyms:

• 3-(3-CHLORO-5-FLUOROPHENYL)-3'-METHOXYPROPIOPHENONE