CAS 898750-29-3

(3-bromophenyl)-[2-(morpholinomethyl)phenyl]methanone

Description:

(3-bromophenyl)-[2-(morpholinomethyl)phenyl]methanone, identified by its CAS number 898750-29-3, is an organic compound characterized by its complex structure, which includes a bromophenyl group and a morpholinomethyl substituent. This compound features a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the bromine atom enhances its electrophilic properties, making it useful in various chemical reactions, including nucleophilic substitutions. The morpholine ring adds to the compound's solubility in polar solvents and may influence its biological activity, as morpholine derivatives are often explored for pharmacological properties. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, its unique combination of functional groups may allow for further derivatization, expanding its utility in research and industry. Overall, this compound exemplifies the intricate interplay of functional groups in organic chemistry, leading to diverse chemical behaviors and potential applications.

Formula: C₁₈H₁₈BrNO₂

InChI: InChI=1/C18H18BrNO2/c19-16-6-3-5-14(12-16)18(21)17-7-2-1-4-15(17)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

SMILES: c1ccc(c(c1)CN1CCOCC1)C(=O)c1cccc(c1)Br

3′-Bromo-2-morpholinomethyl benzophenone

CAS: 898750-29-3

Formula: C₁₈H₁₈BrNO₂

Purity: 97.0%

Molecular weight: 360.251

Ref: 10-F205126