CAS 898750-32-8

(4-bromophenyl)-[2-(morpholinomethyl)phenyl]methanone

Description:

(4-bromophenyl)-[2-(morpholinomethyl)phenyl]methanone, with the CAS number 898750-32-8, is an organic compound characterized by its complex structure, which includes a brominated phenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility in various organic solvents. The presence of the bromine atom enhances its electrophilic character, making it a candidate for further chemical modifications. The morpholine ring introduces a heterocyclic element, which can influence the compound's biological activity and interaction with biological targets. As a ketone, it features a carbonyl group that can participate in various chemical reactions, including nucleophilic additions. This compound may be of interest in medicinal chemistry and material science due to its potential applications in drug development and as a building block for more complex molecules. However, specific physical and chemical properties such as melting point, boiling point, and solubility would need to be determined experimentally or sourced from reliable databases for precise applications.

Formula: C₁₈H₁₈BrNO₂

InChI: InChI=1/C18H18BrNO2/c19-16-7-5-14(6-8-16)18(21)17-4-2-1-3-15(17)13-20-9-11-22-12-10-20/h1-8H,9-13H2

SMILES: c1ccc(c(c1)CN1CCOCC1)C(=O)c1ccc(cc1)Br

4′-Bromo-2-morpholinomethyl benzophenone

CAS: 898750-32-8

Formula: C₁₈H₁₈BrNO₂

Purity: 97.0%

Molecular weight: 360.251

Ref: 10-F205127