CAS 898750-35-1

Methanone, (3-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chlorophenyl group indicates that it has a chlorine atom substituted on a phenyl ring, which can influence its reactivity and physical properties. The compound also features a morpholine moiety, a six-membered ring containing both nitrogen and oxygen, which contributes to its potential biological activity and solubility characteristics. This compound may exhibit properties typical of both ketones and aromatic compounds, such as volatility and the ability to engage in electrophilic substitution reactions. Its specific applications and biological activity would depend on its interactions with various biological targets, making it of interest in medicinal chemistry and drug development. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₁₈H₁₈ClNO₂

InChI: InChI=1S/C18H18ClNO2/c19-16-6-3-5-14(12-16)18(21)17-7-2-1-4-15(17)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

InChI key: InChIKey=RKSFETSNPGQUNE-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=CC(Cl)=CC=C2)C=CC=C1)N3CCOCC3

Synonyms:

• (3-Chlorophenyl)[2-(4-morpholinylmethyl)phenyl]methanone
• 3′-Chloro-2-morpholinomethyl benzophenone
• Methanone, (3-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

3′-Chloro-2-morpholinomethyl benzophenone

CAS: 898750-35-1

Formula: C₁₈H₁₈ClNO₂

Purity: 97.0%

Molecular weight: 315.8

Ref: 10-F205128