CAS 898750-38-4

Methanone, (4-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and a chlorophenyl moiety. The presence of the morpholine ring indicates that it has potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. This compound features a chlorinated aromatic ring, which can influence its reactivity and biological activity. The morpholine group contributes to its solubility and may enhance interactions with biological targets. The molecular structure suggests that it may exhibit specific pharmacological properties, potentially acting as a ligand or inhibitor in various biochemical pathways. Additionally, the compound's stability, solubility, and reactivity can be influenced by the substituents on the aromatic rings. Overall, Methanone, (4-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]- represents a class of compounds that may be of interest in drug discovery and development due to their unique structural features and potential biological activities.

Formula: C₁₈H₁₈ClNO₂

InChI: InChI=1S/C18H18ClNO2/c19-16-7-5-14(6-8-16)18(21)17-4-2-1-3-15(17)13-20-9-11-22-12-10-20/h1-8H,9-13H2

InChI key: InChIKey=QRLTXYMYONMZFY-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=CC=C(Cl)C=C3

Synonyms:

• (4-Chlorophenyl)[2-(4-morpholinylmethyl)phenyl]methanone
• 4′-Chloro-2-morpholinomethyl benzophenone
• Methanone, (4-chlorophenyl)[2-(4-morpholinylmethyl)phenyl]-

4′-Chloro-2-morpholinomethyl benzophenone

CAS: 898750-38-4

Formula: C₁₈H₁₈ClNO₂

Purity: 97.0%

Molecular weight: 315.8

Ref: 10-F205129