CAS 898750-41-9

(3-fluorophenyl)-[2-(morpholinomethyl)phenyl]methanone

Description:

(3-fluorophenyl)-[2-(morpholinomethyl)phenyl]methanone, with the CAS number 898750-41-9, is a chemical compound characterized by its complex structure, which includes a fluorinated phenyl group and a morpholinomethyl substituent. This compound typically exhibits properties associated with both aromatic and aliphatic systems, contributing to its potential reactivity and solubility characteristics. The presence of the fluorine atom can enhance lipophilicity and influence the compound's electronic properties, potentially affecting its biological activity. Morpholine, a cyclic amine, introduces a nitrogen atom that can participate in hydrogen bonding and may enhance the compound's interaction with biological targets. The methanone functional group indicates the presence of a carbonyl, which can be involved in various chemical reactions, including nucleophilic attacks. Overall, this compound may be of interest in medicinal chemistry and drug development due to its structural features that could influence pharmacological properties. However, specific applications and biological activities would require further investigation through empirical studies.

Formula: C₁₈H₁₈FNO₂

InChI: InChI=1/C18H18FNO2/c19-16-6-3-5-14(12-16)18(21)17-7-2-1-4-15(17)13-20-8-10-22-11-9-20/h1-7,12H,8-11,13H2

SMILES: c1ccc(c(c1)CN1CCOCC1)C(=O)c1cccc(c1)F

3′-Fluoro-2-morpholinomethyl benzophenone

CAS: 898750-41-9

Formula: C₁₈H₁₈FNO₂

Purity: 97.0%

Molecular weight: 299.345

Ref: 10-F205130