CymitQuimica logo

CAS 898750-43-1

:

3-(3-chloro-5-fluoro-phenyl)-1-(4-methylsulfanylphenyl)propan-1-one

Description:
3-(3-Chloro-5-fluoro-phenyl)-1-(4-methylsulfanylphenyl)propan-1-one, with the CAS number 898750-43-1, is a synthetic organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a chloro and a fluoro group on one phenyl ring and a methylsulfanyl group on another. This compound is likely to exhibit properties typical of ketones, including potential reactivity in nucleophilic addition reactions due to the carbonyl group. The presence of halogen substituents (chlorine and fluorine) can influence its reactivity, stability, and lipophilicity, potentially enhancing its biological activity. The methylsulfanyl group may also contribute to its chemical behavior, possibly affecting solubility and interaction with biological targets. Such compounds are often of interest in medicinal chemistry and materials science due to their potential applications in drug development and as intermediates in organic synthesis. However, specific physical properties such as melting point, boiling point, and solubility would require empirical measurement or literature reference for precise values.
Formula:C16H14ClFOS
InChI:InChI=1/C16H14ClFOS/c1-20-15-5-3-12(4-6-15)16(19)7-2-11-8-13(17)10-14(18)9-11/h3-6,8-10H,2,7H2,1H3
SMILES:CSc1ccc(cc1)C(=O)CCc1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.