CAS 898750-44-2
:Methanone, (2,3-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]-
Description:
Methanone, (2,3-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of the 2,3-dimethylphenyl group indicates that it has two methyl substituents on the phenyl ring, contributing to its hydrophobic character. Additionally, the compound features a morpholine ring, which is a six-membered heterocyclic structure containing both nitrogen and oxygen, enhancing its potential for biological activity. This compound may exhibit properties such as moderate solubility in organic solvents and potential interactions with biological targets due to the presence of the morpholine moiety. Its molecular structure suggests it could be of interest in medicinal chemistry, particularly in the development of pharmaceuticals. However, specific physical and chemical properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization. Overall, this compound represents a class of organic molecules that may have applications in various fields, including drug development and materials science.
Formula:C20H23NO2
InChI:InChI=1S/C20H23NO2/c1-15-6-5-9-18(16(15)2)20(22)19-8-4-3-7-17(19)14-21-10-12-23-13-11-21/h3-9H,10-14H2,1-2H3
InChI key:InChIKey=TTYJLSFASXIQNW-UHFFFAOYSA-N
SMILES:C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=C(C)C(C)=CC=C3
Synonyms:- 2,3-Dimethyl-2′-morpholinomethyl benzophenone
- Methanone, (2,3-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]-
- (2,3-Dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]methanone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.