CAS 898750-46-4

1-(3-bromophenyl)-3-(3-chloro-5-fluoro-phenyl)propan-1-one

Description:

1-(3-bromophenyl)-3-(3-chloro-5-fluoro-phenyl)propan-1-one, with the CAS number 898750-46-4, is an organic compound characterized by its ketone functional group and a propanone backbone. This compound features two aromatic rings: one containing a bromine substituent and the other containing both a chlorine and a fluorine substituent, which contribute to its unique chemical properties. The presence of halogens (bromine, chlorine, and fluorine) typically enhances the compound's reactivity and can influence its solubility and stability. The molecular structure suggests potential applications in pharmaceuticals or agrochemicals, where such halogenated compounds are often utilized for their biological activity. Additionally, the compound's specific arrangement of substituents may affect its electronic properties, making it of interest for studies in medicinal chemistry or materials science. As with many organic compounds, safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.

Formula: C₁₅H₁₁BrClFO

InChI: InChI=1/C15H11BrClFO/c16-12-3-1-2-11(8-12)15(19)5-4-10-6-13(17)9-14(18)7-10/h1-3,6-9H,4-5H2

SMILES: c1cc(cc(c1)Br)C(=O)CCc1cc(cc(c1)F)Cl