CAS 898750-49-7

1-(4-bromophenyl)-3-(3-chloro-5-fluoro-phenyl)propan-1-one

Description:

1-(4-bromophenyl)-3-(3-chloro-5-fluoro-phenyl)propan-1-one, with the CAS number 898750-49-7, is an organic compound characterized by its ketone functional group, specifically a propanone structure. This compound features a propan-1-one backbone substituted with a 4-bromophenyl group and a 3-chloro-5-fluorophenyl group, which contribute to its unique chemical properties. The presence of halogen atoms (bromine, chlorine, and fluorine) enhances its reactivity and may influence its biological activity, making it of interest in medicinal chemistry and material science. The compound is likely to exhibit moderate to high lipophilicity due to the aromatic rings, which can affect its solubility in organic solvents. Additionally, the specific arrangement of substituents can lead to interesting electronic properties, potentially impacting its behavior in chemical reactions. As with many halogenated compounds, it may also exhibit distinct spectral characteristics in techniques such as NMR and IR spectroscopy, aiding in its identification and characterization in laboratory settings.

Formula: C₁₅H₁₁BrClFO

InChI: InChI=1/C15H11BrClFO/c16-12-4-2-11(3-5-12)15(19)6-1-10-7-13(17)9-14(18)8-10/h2-5,7-9H,1,6H2

SMILES: C(CC(=O)c1ccc(cc1)Br)c1cc(cc(c1)F)Cl