CAS 898750-50-0

Methanone, (2,5-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,5-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,5-dimethylphenyl group indicates that the compound has substituents that can influence its reactivity and physical properties, such as solubility and boiling point. The morpholinylmethyl group suggests that the compound may exhibit interesting pharmacological properties, as morpholine derivatives are often associated with biological activity. This compound is likely to be a solid at room temperature, given its structural characteristics, and may be soluble in organic solvents. Its molecular structure may allow for interactions such as hydrogen bonding and π-π stacking, which can affect its stability and reactivity. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Further studies would be necessary to fully understand its properties and potential applications in various fields, including pharmaceuticals and materials science.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-15-7-8-16(2)19(13-15)20(22)18-6-4-3-5-17(18)14-21-9-11-23-12-10-21/h3-8,13H,9-12,14H2,1-2H3

InChI key: InChIKey=DTPIBDKXMQXCFI-UHFFFAOYSA-N

SMILES: C(C1=C(C(=O)C2=C(C)C=CC(C)=C2)C=CC=C1)N3CCOCC3

Synonyms:

• (2,5-Dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]methanone
• Methanone, (2,5-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]-

2,5-Dimethyl-2′-morpholinomethyl benzophenone

CAS: 898750-50-0

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F205134