CAS 898750-52-2
:1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3-chlorophenyl)-
Description:
1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3-chlorophenyl)-, also known by its CAS number 898750-52-2, is an organic compound characterized by its ketone functional group, which is central to its structure. This compound features a propanone backbone with two distinct aromatic substituents: a 3-chloro-5-fluorophenyl group and a 3-chlorophenyl group. The presence of chlorine and fluorine atoms in the aromatic rings contributes to its chemical reactivity and potential biological activity. Typically, compounds of this nature may exhibit properties such as lipophilicity, which can influence their solubility in organic solvents and biological systems. The chlorinated and fluorinated aromatic rings may also enhance the compound's stability and alter its interaction with biological targets, making it of interest in medicinal chemistry and material science. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or environmental impact.
Formula:C15H11Cl2FO
InChI:InChI=1S/C15H11Cl2FO/c16-12-3-1-2-11(8-12)15(19)5-4-10-6-13(17)9-14(18)7-10/h1-3,6-9H,4-5H2
InChI key:InChIKey=BWOSCMMOPNKQPL-UHFFFAOYSA-N
SMILES:C(CC(=O)C1=CC(Cl)=CC=C1)C2=CC(Cl)=CC(F)=C2
Synonyms:- 3-(3-Chloro-5-fluorophenyl)-1-(3-chlorophenyl)-1-propanone
- 1-Propanone, 3-(3-chloro-5-fluorophenyl)-1-(3-chlorophenyl)-
- 3′-Chloro-3-(3-chloro-5-fluorophenyl)propiophenone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.