CAS 898750-53-3

Methanone, (2,6-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (2,6-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and two distinct aromatic rings. The presence of the 2,6-dimethylphenyl group indicates that the compound has methyl substituents on the aromatic ring, which can influence its reactivity and physical properties. Additionally, the incorporation of a morpholinylmethyl group suggests potential for interactions with biological systems, as morpholine derivatives are often used in pharmaceuticals. This compound may exhibit properties such as moderate solubility in organic solvents and potential biological activity, making it of interest in medicinal chemistry. Its molecular structure likely contributes to its stability and reactivity, with the potential for various chemical transformations. As with many organic compounds, safety data and handling precautions should be considered, particularly regarding toxicity and environmental impact. Overall, this compound represents a unique combination of functional groups that may be explored for various applications in research and industry.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-15-6-5-7-16(2)19(15)20(22)18-9-4-3-8-17(18)14-21-10-12-23-13-11-21/h3-9H,10-14H2,1-2H3

InChI key: InChIKey=MYSLONGKOAQHSR-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=C(C)C=CC=C3C

Synonyms:

• Methanone, (2,6-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]-
• 2,6-Dimethyl-2′-morpholinomethyl benzophenone
• (2,6-Dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]methanone