CAS 898750-55-5
:3-(3-chloro-5-fluoro-phenyl)-1-(4-chlorophenyl)propan-1-one
Description:
3-(3-Chloro-5-fluoro-phenyl)-1-(4-chlorophenyl)propan-1-one, identified by its CAS number 898750-55-5, is an organic compound characterized by its ketone functional group and a complex aromatic structure. This compound features a propanone backbone with two distinct phenyl groups, one of which is substituted with both chlorine and fluorine atoms, contributing to its unique chemical properties. The presence of halogen substituents, specifically chlorine and fluorine, can influence the compound's reactivity, stability, and lipophilicity, making it of interest in various chemical applications, including pharmaceuticals and agrochemicals. The molecular structure suggests potential for interactions with biological systems, which may be explored for therapeutic purposes. Additionally, the compound's physical properties, such as melting point, boiling point, and solubility, would be influenced by its molecular weight and the nature of its substituents. Overall, this compound exemplifies the complexity and diversity of organic chemistry, particularly in the design of molecules with specific functional characteristics.
Formula:C15H11Cl2FO
InChI:InChI=1/C15H11Cl2FO/c16-12-4-2-11(3-5-12)15(19)6-1-10-7-13(17)9-14(18)8-10/h2-5,7-9H,1,6H2
SMILES:C(CC(=O)c1ccc(cc1)Cl)c1cc(cc(c1)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.