CymitQuimica logo

CAS 898750-58-8

:

3-(3-chloro-5-fluoro-phenyl)-1-(3-fluorophenyl)propan-1-one

Description:
3-(3-Chloro-5-fluoro-phenyl)-1-(3-fluorophenyl)propan-1-one, with the CAS number 898750-58-8, is an organic compound characterized by its complex structure featuring multiple aromatic rings and halogen substituents. This compound typically exhibits a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of chlorine and fluorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, its unique arrangement of substituents can affect its physical properties, such as melting point, boiling point, and solubility in different solvents. As with many halogenated compounds, it is essential to consider environmental and health implications, as halogens can impact toxicity and bioaccumulation. Overall, this compound represents a significant interest in research fields focused on drug development and material science.
Formula:C15H11ClF2O
InChI:InChI=1/C15H11ClF2O/c16-12-6-10(7-14(18)9-12)4-5-15(19)11-2-1-3-13(17)8-11/h1-3,6-9H,4-5H2
SMILES:c1cc(cc(c1)F)C(=O)CCc1cc(cc(c1)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.