CAS 898750-59-9

Methanone, (3,5-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (3,5-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a ketone functional group and multiple aromatic rings. The presence of the 3,5-dimethylphenyl group indicates that it has two methyl substituents on a phenyl ring, enhancing its hydrophobic character. The compound also features a morpholine moiety, which is a six-membered ring containing both oxygen and nitrogen, contributing to its potential biological activity and solubility properties. This compound may exhibit interesting pharmacological properties due to the combination of its aromatic and heterocyclic components, making it a subject of interest in medicinal chemistry. Its molecular structure suggests potential interactions with biological targets, which could be explored in drug development. Additionally, the presence of multiple functional groups may influence its reactivity and stability under various conditions. Overall, Methanone, (3,5-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]- represents a class of compounds that could have applications in pharmaceuticals or materials science.

Formula: C₂₀H₂₃NO₂

InChI: InChI=1S/C20H23NO2/c1-15-11-16(2)13-18(12-15)20(22)19-6-4-3-5-17(19)14-21-7-9-23-10-8-21/h3-6,11-13H,7-10,14H2,1-2H3

InChI key: InChIKey=QMAIRIKWZUVFHI-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=CC(C)=CC(C)=C3

Synonyms:

• Methanone, (3,5-dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]-
• (3,5-Dimethylphenyl)[2-(4-morpholinylmethyl)phenyl]methanone

3′,5′-Dimethyl-2-morpholinomethyl benzophenone

CAS: 898750-59-9

Formula: C₂₀H₂₃NO₂

Purity: 97.0%

Molecular weight: 309.409

Ref: 10-F205137