CAS 898750-61-3
:3-(3-chloro-5-fluoro-phenyl)-1-(4-fluorophenyl)propan-1-one
Description:
3-(3-Chloro-5-fluoro-phenyl)-1-(4-fluorophenyl)propan-1-one, with the CAS number 898750-61-3, is an organic compound characterized by its complex structure featuring multiple aromatic rings and halogen substituents. This compound typically exhibits a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The presence of fluorine and chlorine atoms enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The compound's molecular structure suggests it may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, its unique arrangement of substituents can lead to interesting electronic properties, potentially affecting its interaction with biological targets. As with many halogenated compounds, considerations regarding environmental impact and toxicity are essential, particularly in the context of regulatory compliance and safety assessments. Overall, this compound represents a valuable entity for further exploration in medicinal chemistry and material science.
Formula:C15H11ClF2O
InChI:InChI=1/C15H11ClF2O/c16-12-7-10(8-14(18)9-12)1-6-15(19)11-2-4-13(17)5-3-11/h2-5,7-9H,1,6H2
SMILES:C(CC(=O)c1ccc(cc1)F)c1cc(cc(c1)F)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.