CAS 898750-64-6

3-(3-chloro-5-fluoro-phenyl)-1-(2,3-dimethylphenyl)propan-1-one

Description:

3-(3-chloro-5-fluoro-phenyl)-1-(2,3-dimethylphenyl)propan-1-one, with the CAS number 898750-64-6, is an organic compound characterized by its complex structure, which includes a propanone backbone substituted with both a chloro and a fluoro group on one phenyl ring, and a dimethyl-substituted phenyl group on the other. This compound typically exhibits properties associated with ketones, such as being a liquid or solid at room temperature, depending on its specific formulation and purity. Its molecular structure suggests potential reactivity due to the presence of halogen substituents, which can influence its chemical behavior, including electrophilic aromatic substitution reactions. The presence of multiple aromatic rings may also contribute to its stability and potential applications in pharmaceuticals or agrochemicals. Additionally, the compound's unique substituents may impart specific biological activities, making it of interest in medicinal chemistry. However, detailed studies would be necessary to fully understand its physical properties, reactivity, and potential applications.

Formula: C₁₇H₁₆ClFO

InChI: InChI=1/C17H16ClFO/c1-11-4-3-5-16(12(11)2)17(20)7-6-13-8-14(18)10-15(19)9-13/h3-5,8-10H,6-7H2,1-2H3

SMILES: Cc1cccc(c1C)C(=O)CCc1cc(cc(c1)F)Cl