CAS 898750-65-7

Methanone, (4-chloro-3-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]-

Description:

Methanone, (4-chloro-3-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]- is an organic compound characterized by its complex structure, which includes a methanone functional group and multiple aromatic rings. The presence of a chloro and a fluoro substituent on the phenyl rings contributes to its unique chemical properties, potentially influencing its reactivity and interactions. The morpholine moiety introduces a heterocyclic element, which can enhance solubility and biological activity. This compound may exhibit significant pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. The CAS number 898750-65-7 serves as a unique identifier for this substance, facilitating its identification in chemical databases and literature. Overall, the characteristics of this compound, including its functional groups and structural features, suggest a versatile role in various chemical and biological contexts.

Formula: C₁₈H₁₇ClFNO₂

InChI: InChI=1S/C18H17ClFNO2/c19-16-6-5-13(11-17(16)20)18(22)15-4-2-1-3-14(15)12-21-7-9-23-10-8-21/h1-6,11H,7-10,12H2

InChI key: InChIKey=AEPHVJMLYFNNSK-UHFFFAOYSA-N

SMILES: C(=O)(C1=C(CN2CCOCC2)C=CC=C1)C3=CC(F)=C(Cl)C=C3

Synonyms:

• Methanone, (4-chloro-3-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]-
• 4′-Chloro-3′-fluoro-2-morpholinomethyl benzophenone
• (4-Chloro-3-fluorophenyl)[2-(4-morpholinylmethyl)phenyl]methanone

4′-Chloro-3′-fluoro-2-morpholinomethyl benzophenone

CAS: 898750-65-7

Formula: C₁₈H₁₇ClFNO₂

Purity: 97.0%

Molecular weight: 333.79

Ref: 10-F205138